Molecular Definition

Canonical SMILES COc1ccc(CNC(=O)c2ccc(OC(F)F)c(OC3CCCC3)c2)cc1
Formula C21H23F2NO4
Molecular Weight 391.41 da
Stereocenters 0/0