Molecular Definition

Canonical SMILES CCN(CC)C(=O)Cc1ccc(Cn2nnc3C(=O)c4ccccc4C(=O)c23)cc1
Formula C23H22N4O3
Molecular Weight 402.45 da
Stereocenters 0/0