Target Relevance

Molecular Definition

Canonical SMILES CN1CCN(CC1)C(=O)c2ccc(Cn3nnc4C(=O)c5ccccc5C(=O)c34)cc2
Formula C23H21N5O3
Molecular Weight 415.44 da
Stereocenters 0/0