Molecular Definition

Canonical SMILES CC(=O)N1CCN(CC1)C(=O)c2cccc(Cn3nnc4C(=O)c5ccccc5C(=O)c34)c2
Formula C24H21N5O4
Molecular Weight 443.45 da
Stereocenters 0/0