Target Relevance

Molecular Definition

Canonical SMILES CCN(CC)C(=O)c1ccc(Cn2nnc3C(=O)c4ccccc4C(=O)c23)cc1
Formula C22H20N4O3
Molecular Weight 388.42 da
Stereocenters 0/0