Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1ccc(Cn2nnc3C(=O)c4ccccc4C(=O)c23)cc1
Formula C18H11N3O4
Molecular Weight 333.30 da
Stereocenters 0/0