Molecular Definition

Canonical SMILES Clc1cccc(Cn2nnc3C(=O)c4ccccc4C(=O)c23)c1
Formula C17H10ClN3O2
Molecular Weight 323.73 da
Stereocenters 0/0