Molecular Definition

Canonical SMILES Oc1ccc(\C=C\C(=O)OCCc2cccc(O)c2)cc1
Formula C17H16O4
Molecular Weight 284.31 da
Stereocenters 0/0