Molecular Definition

Canonical SMILES Oc1ccc(CCOc2ccc(CCOC(=O)\C=C\c3ccc(O)c(O)c3)cc2)cc1
Formula C25H24O6
Molecular Weight 420.45 da
Stereocenters 0/0