Molecular Definition

Canonical SMILES Oc1c(Br)c(Br)c(Br)c(Br)c1Oc2ccc(Br)cc2Br
Formula C12H4Br6O2
Molecular Weight 659.58 da
Stereocenters 0/0