Molecular Definition

Canonical SMILES CC1(C)CC(=O)C2=C(C1)N(C3=C(C2c4ccc(N)cc4)C(=O)CC(C)(C)C3)c5ccc(cc5)S(=O)(=O)N
Formula C29H33N3O4S
Molecular Weight 519.66 da
Stereocenters 0/0