Molecular Definition

Canonical SMILES Nc1ncc(C(=O)NC2CC2)c3ccc(cc13)c4cccc(F)c4
Formula C19H16FN3O
Molecular Weight 321.35 da
Stereocenters 0/0