Molecular Definition

Canonical SMILES NC(=O)c1cnc(N)c2cc(ccc12)c3cccc(F)c3
Formula C16H12FN3O
Molecular Weight 281.28 da
Stereocenters 0/0