Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(=O)Cc3ccc(F)cc3
Formula C19H15ClFNO3
Molecular Weight 359.78 da
Stereocenters 0/0