Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)c1[nH]c2cc(Cl)ccc2c1C(=O)C
Formula C13H12ClNO3
Molecular Weight 265.69 da
Stereocenters 0/0