Molecular Definition

Canonical SMILES C\C=C\1/NC(=O)c2csc(CNC(=O)C[C@H](OC(=O)[C@@H](NC1=O)C(C)C)\C=C\CCSC(=O)C)n2
Formula C23H30N4O6S2
Molecular Weight 522.64 da
Stereocenters 2/2