Molecular Definition

Canonical SMILES Cc1nc2ccccc2nc1SCC(=O)NC(=O)Nc3ccccc3
Formula C18H16N4O2S
Molecular Weight 352.41 da
Stereocenters 0/0