Molecular Definition

Canonical SMILES Cc1nn(c(C)c1NC(=O)CN2CCCC(C2)c3nc4ccccc4s3)c5ccccc5
Formula C25H27N5OS
Molecular Weight 445.58 da
Stereocenters 0/1