Molecular Definition

Canonical SMILES CCNC(=O)NC[C@@H]1C[C@H]1c2cccc3oc(CCCCc4ccccc4)cc23
Formula C25H30N2O2
Molecular Weight 390.52 da
Stereocenters 2/2