Molecular Definition

Canonical SMILES CC(C)C(=O)NC[C@@H]1C[C@H]1c2cccc3O[C@H](CCCCc4ccccc4)Cc23
Formula C26H33NO2
Molecular Weight 391.55 da
Stereocenters 3/3