Target Relevance

Molecular Definition

Canonical SMILES CC1OC(OC2C(O)C(O)C(OC3C(O)C(O)C(NC4C(C)OC(OC5C(O)C(O)C(O)OC5CO)C(O)C4O)C=C3CO)OC2CO)C(O)C(O)C1NC6C=C(CO)C(O)C(O)C6O
Formula C38H64N2O25
Molecular Weight 948.91 da
Stereocenters 0/28