Molecular Definition

Canonical SMILES CC(C)CCC1=CC(=O)n2nc(NCc3ccc(Cl)cc3)c(C#N)c2N1
Formula C19H20ClN5O
Molecular Weight 369.85 da
Stereocenters 0/0