Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(NCc3ccc(Cl)cc3)c(C#N)c2N1
Formula C17H16ClN5O
Molecular Weight 341.80 da
Stereocenters 0/0