Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(NCc3ccc(Br)cc3)nc2N1
Formula C15H16BrN5O
Molecular Weight 362.22 da
Stereocenters 0/0