Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(CC(=O)N3CCCC3)c(C#N)c2N1
Formula C16H19N5O2
Molecular Weight 313.35 da
Stereocenters 0/0