Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(NCc3ccc(Cl)cc3OC)c(C#N)c2N1
Formula C18H18ClN5O2
Molecular Weight 371.82 da
Stereocenters 0/0