Molecular Definition

Canonical SMILES CCCC1=CC(=O)n2nc(NCc3ccc(Cl)c(C)c3)c(C#N)c2N1
Formula C18H18ClN5O
Molecular Weight 355.82 da
Stereocenters 0/0