Target Relevance

Molecular Definition

Canonical SMILES CN(C1CCCCCCC1)C(=O)Oc2nsnc2N3CCOCC3
Formula C16H26N4O3S
Molecular Weight 354.47 da
Stereocenters 0/0