Target Relevance

Molecular Definition

Canonical SMILES COC1=NN(Cc2cccc(c2)C(F)(F)F)C(=O)O1
Formula C11H9F3N2O3
Molecular Weight 274.20 da
Stereocenters 0/0