Target Relevance

Molecular Definition

Canonical SMILES Nc1cccc(CN2N=C(Oc3ccccc3)OC2=O)c1
Formula C15H13N3O3
Molecular Weight 283.28 da
Stereocenters 0/0