Target Relevance

Molecular Definition

Canonical SMILES [O-][N+](=O)c1cccc(CN2N=C(Oc3ccccc3)OC2=O)c1
Formula C15H11N3O5
Molecular Weight 313.26 da
Stereocenters 0/0