Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(OC)c(c1)[C@@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)CSCc2ccccc2
Formula C27H34N2O8S
Molecular Weight 546.63 da
Stereocenters 3/3