Molecular Definition

Canonical SMILES CCCCOc1ccc(NS(=O)(=O)c2ccc3CN(Cc3c2)C(=O)Nc4ccc(cc4)C(C)(C)C)c(F)c1
Formula C29H34FN3O4S
Molecular Weight 539.66 da
Stereocenters 0/0