Molecular Definition

Canonical SMILES CCOc1cc(F)ccc1NS(=O)(=O)c2ccc3CN(Cc3c2)C(=O)Nc4ccc(cc4)C(C)(C)C
Formula C27H30FN3O4S
Molecular Weight 511.61 da
Stereocenters 0/0