Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(NC(=O)N2Cc3ccc(cc3C2)S(=O)(=O)Nc4ccc(F)cc4F)cc1
Formula C25H25F2N3O3S
Molecular Weight 485.55 da
Stereocenters 0/0