Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc(cc1)c2c[nH]c(n2)C3(CCCC3)NCc4ccccc4
Formula C22H25N3
Molecular Weight 331.45 da
Stereocenters 0/0