Molecular Definition

Canonical SMILES C1CC(C1)c2cc(Nc3nc(Nc4ccc5[nH]cnc5c4)nc6ccccc36)n[nH]2
Formula C22H20N8
Molecular Weight 396.45 da
Stereocenters 0/0