Molecular Definition

Canonical SMILES Cc1cc(NCc2c(F)cccc2C(F)(F)F)c3cccc(C(=O)N)c3n1
Formula C19H15F4N3O
Molecular Weight 377.34 da
Stereocenters 0/0