Target Relevance

Molecular Definition

Canonical SMILES Fc1ccc(NC(=O)c2cn[nH]n2)cc1
Formula C9H7FN4O
Molecular Weight 206.18 da
Stereocenters 0/0