Target Relevance

Molecular Definition

Canonical SMILES O=C(Nc1ccc2ncccc2c1)c3cc[nH]n3
Formula C13H10N4O
Molecular Weight 238.24 da
Stereocenters 0/0