Target Relevance

Molecular Definition

Canonical SMILES O=C1C=C(Oc2c3OCOc3ccc12)c4ccccc4
Formula C16H10O4
Molecular Weight 266.25 da
Stereocenters 0/0