Molecular Definition

Canonical SMILES Cc1oc2cc(O)c3C(=O)C=C(Oc3c2c1)c4ccccc4
Formula C18H12O4
Molecular Weight 292.29 da
Stereocenters 0/0