Molecular Definition

Canonical SMILES CC(C)c1ccc2c(c1)c(C(=O)c3ccccc3C)c(CC(C)(C)C(=O)O)n2Cc4ccc(Cl)cc4
Formula C31H32ClNO3
Molecular Weight 502.04 da
Stereocenters 0/0