Molecular Definition

Canonical SMILES CC(C)Oc1cc(Nc2ncc(c(N[C@@H]3C[C@H](CO)[C@@H](O)[C@H]3O)n2)c4ccc5ccccc5n4)ccn1
Formula C27H30N6O4
Molecular Weight 502.56 da
Stereocenters 4/4