Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1[C@@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)CSCc2ccccc2)C(=O)C
Formula C28H34N2O8S
Molecular Weight 558.64 da
Stereocenters 3/3