Molecular Definition

Canonical SMILES Cc1c(F)cccc1CCCCOc2ccc(cc2)C#Cc3cccc4c(CCCC(=O)O)c(C)n(CCCC(=O)O)c34
Formula C36H38FNO5
Molecular Weight 583.69 da
Stereocenters 0/0