Molecular Definition

Canonical SMILES Cc1c(CCCC(=O)O)c2c(F)ccc(C#Cc3ccc(OCCCCc4c(F)cc(F)c(F)c4F)cc3)c2n1CCCC(=O)O
Formula C35H32F5NO5
Molecular Weight 641.62 da
Stereocenters 0/0