Molecular Definition

Canonical SMILES Cc1c(Cl)cccc1CCCCOc2ccc(cc2)C#Cc3cccc4c(CCC(=O)O)c(C)n(CCCCC(=O)O)c34
Formula C36H38ClNO5
Molecular Weight 600.14 da
Stereocenters 0/0