Molecular Definition

Canonical SMILES Cc1c(Cl)cccc1CCCCOc2ccc(cc2)C#Cc3cccc4c(CC(=O)O)c(C)n(CCCC(=O)O)c34
Formula C34H34ClNO5
Molecular Weight 572.09 da
Stereocenters 0/0