Molecular Definition

Canonical SMILES Cc1c(Cl)cccc1CCCCOc2ccc(cc2)C#Cc3cccc4c(CCCC(=O)O)c(C)n(CCC(=O)O)c34
Formula C35H36ClNO5
Molecular Weight 586.12 da
Stereocenters 0/0